C15H26F3NO — CID 170369368
1-[[1-[(2-methylpropan-2-yl)oxymethyl]cyclopropyl]methyl]-4-(trifluoromethyl)piperidine (PubChem CID 170369368) has the molecular formula C15H26F3NO and a molecular weight of 293.37 g/mol. Its IUPAC name is 1-[[1-[(2-methylpropan-2-yl)oxymethyl]cyclopropyl]methyl]-4-(trifluoromethyl)piperidine.
| Compound Name | 1-[[1-[(2-methylpropan-2-yl)oxymethyl]cyclopropyl]methyl]-4-(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 170369368 |
| Molecular Formula | C15H26F3NO |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | 1-[[1-[(2-methylpropan-2-yl)oxymethyl]cyclopropyl]methyl]-4-(trifluoromethyl)piperidine |
| SMILES | CC(C)(C)OCC1(CN2CCC(C(F)(F)F)CC2)CC1 |
| InChI | InChI=1S/C15H26F3NO/c1-13(2,3)20-11-14(6-7-14)10-19-8-4-12(5-9-19)15(16,17)18/h12H,4-11H2,1-3H3 |
| InChIKey | STCJDSICOGVYIW-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |