C33H35F2N5O2 — CID 170369733
1-[4-[7-(1,1a,6,6a-tetrahydrocyclopropa[a]inden-2-yl)-6-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-4-yl]piperazin-1-yl]-2-fluoroprop-2-en-1-one (PubChem CID 170369733) has the molecular formula C33H35F2N5O2 and a molecular weight of 571.67 g/mol. Its IUPAC name is 1-[4-[7-(1,1a,6,6a-tetrahydrocyclopropa[a]inden-2-yl)-6-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-4-yl]piperazin-1-yl]-2-fluoroprop-2-en-1-one.
| Compound Name | 1-[4-[7-(1,1a,6,6a-tetrahydrocyclopropa[a]inden-2-yl)-6-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-4-yl]piperazin-1-yl]-2-fluoroprop-2-en-1-one |
|---|---|
| PubChem CID | 170369733 |
| Molecular Formula | C33H35F2N5O2 |
| Molecular Weight | 571.67 g/mol |
| Exact Mass | 571.28 |
| IUPAC Name | 1-[4-[7-(1,1a,6,6a-tetrahydrocyclopropa[a]inden-2-yl)-6-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-4-yl]piperazin-1-yl]-2-fluoroprop-2-en-1-one |
| SMILES | C=C(F)C(=O)N1CCN(c2nc(OCC34CCCN3CCC4)nc3cc(-c4cccc5c4C4CC4C5)c(F)cc23)CC1 |
| InChI | InChI=1S/C33H35F2N5O2/c1-20(34)31(41)39-13-11-38(12-14-39)30-26-17-27(35)25(23-6-2-5-21-15-22-16-24(22)29(21)23)18-28(26)36-32(37-30)42-19-33-7-3-9-40(33)10-4-8-33/h2,5-6,17-18,22,24H,1,3-4,7-16,19H2 |
| InChIKey | VXRQQSRLWHJDRJ-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.67 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|