C31H34FN5O2 — CID 171412212
N-[2-[[7-[(1aS,6aS)-1,1a,6,6a-tetrahydrocyclopropa[a]inden-2-yl]-6-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-4-yl]amino]ethyl]prop-2-enamide (PubChem CID 171412212) has the molecular formula C31H34FN5O2 and a molecular weight of 527.64 g/mol. Its IUPAC name is N-[2-[[7-[(1aS,6aS)-1,1a,6,6a-tetrahydrocyclopropa[a]inden-2-yl]-6-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-4-yl]amino]ethyl]prop-2-enamide.
| Compound Name | N-[2-[[7-[(1aS,6aS)-1,1a,6,6a-tetrahydrocyclopropa[a]inden-2-yl]-6-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-4-yl]amino]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 171412212 |
| Molecular Formula | C31H34FN5O2 |
| Molecular Weight | 527.64 g/mol |
| Exact Mass | 527.27 |
| IUPAC Name | N-[2-[[7-[(1aS,6aS)-1,1a,6,6a-tetrahydrocyclopropa[a]inden-2-yl]-6-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-4-yl]amino]ethyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCNc1nc(OCC23CCCN2CCC3)nc2cc(-c3cccc4c3[C@H]3C[C@H]3C4)c(F)cc12 |
| InChI | InChI=1S/C31H34FN5O2/c1-2-27(38)33-10-11-34-29-24-16-25(32)23(21-7-3-6-19-14-20-15-22(20)28(19)21)17-26(24)35-30(36-29)39-18-31-8-4-12-37(31)13-5-9-31/h2-3,6-7,16-17,20,22H,1,4-5,8-15,18H2,(H,33,38)(H,34,35,36)/t20-,22+/m1/s1 |
| InChIKey | KMVPPAZPWGEEJF-IRLDBZIGSA-N |
| XLogP | 4.82 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.64 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|