C29H31F2N5O2 — CID 171412188
N-[2-[[7-(1,1a,6,6a-tetrahydrocyclopropa[a]inden-2-yl)-6,8-difluoro-2-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]quinazolin-4-yl]amino]ethyl]prop-2-enamide (PubChem CID 171412188) has the molecular formula C29H31F2N5O2 and a molecular weight of 519.60 g/mol. Its IUPAC name is N-[2-[[7-(1,1a,6,6a-tetrahydrocyclopropa[a]inden-2-yl)-6,8-difluoro-2-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]quinazolin-4-yl]amino]ethyl]prop-2-enamide.
| Compound Name | N-[2-[[7-(1,1a,6,6a-tetrahydrocyclopropa[a]inden-2-yl)-6,8-difluoro-2-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]quinazolin-4-yl]amino]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 171412188 |
| Molecular Formula | C29H31F2N5O2 |
| Molecular Weight | 519.60 g/mol |
| Exact Mass | 519.24 |
| IUPAC Name | N-[2-[[7-(1,1a,6,6a-tetrahydrocyclopropa[a]inden-2-yl)-6,8-difluoro-2-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]quinazolin-4-yl]amino]ethyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCNc1nc(OC[C@@H]2CCCN2C)nc2c(F)c(-c3cccc4c3C3CC3C4)c(F)cc12 |
| InChI | InChI=1S/C29H31F2N5O2/c1-3-23(37)32-9-10-33-28-21-14-22(30)25(19-8-4-6-16-12-17-13-20(17)24(16)19)26(31)27(21)34-29(35-28)38-15-18-7-5-11-36(18)2/h3-4,6,8,14,17-18,20H,1,5,7,9-13,15H2,2H3,(H,32,37)(H,33,34,35)/t17?,18-,20?/m0/s1 |
| InChIKey | QLBDVKHMYCJTSK-FDYSRKEFSA-N |
| XLogP | 4.42 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.60 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|