C28H31F2N5O2S — CID 171412080
N-[2-[[8-fluoro-7-(5-fluoro-3,4-dihydro-2H-thiochromen-8-yl)-2-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]quinazolin-4-yl]amino]ethyl]prop-2-enamide (PubChem CID 171412080) has the molecular formula C28H31F2N5O2S and a molecular weight of 539.65 g/mol. Its IUPAC name is N-[2-[[8-fluoro-7-(5-fluoro-3,4-dihydro-2H-thiochromen-8-yl)-2-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]quinazolin-4-yl]amino]ethyl]prop-2-enamide.
| Compound Name | N-[2-[[8-fluoro-7-(5-fluoro-3,4-dihydro-2H-thiochromen-8-yl)-2-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]quinazolin-4-yl]amino]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 171412080 |
| Molecular Formula | C28H31F2N5O2S |
| Molecular Weight | 539.65 g/mol |
| Exact Mass | 539.22 |
| IUPAC Name | N-[2-[[8-fluoro-7-(5-fluoro-3,4-dihydro-2H-thiochromen-8-yl)-2-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]quinazolin-4-yl]amino]ethyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCNc1nc(OC[C@@H]2CCCN2C)nc2c(F)c(-c3ccc(F)c4c3SCCC4)ccc12 |
| InChI | InChI=1S/C28H31F2N5O2S/c1-3-23(36)31-12-13-32-27-21-9-8-18(19-10-11-22(29)20-7-5-15-38-26(19)20)24(30)25(21)33-28(34-27)37-16-17-6-4-14-35(17)2/h3,8-11,17H,1,4-7,12-16H2,2H3,(H,31,36)(H,32,33,34)/t17-/m0/s1 |
| InChIKey | OGWPBUZYKXQAKD-KRWDZBQOSA-N |
| XLogP | 4.80 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.65 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|