C31H37N5O2 — CID 171414023
N-[2-[[7-(1,2,3,3a,4,8b-hexahydrocyclopenta[a]inden-8-yl)-2-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]quinazolin-4-yl]amino]ethyl]prop-2-enamide (PubChem CID 171414023) has the molecular formula C31H37N5O2 and a molecular weight of 511.67 g/mol. Its IUPAC name is N-[2-[[7-(1,2,3,3a,4,8b-hexahydrocyclopenta[a]inden-8-yl)-2-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]quinazolin-4-yl]amino]ethyl]prop-2-enamide.
| Compound Name | N-[2-[[7-(1,2,3,3a,4,8b-hexahydrocyclopenta[a]inden-8-yl)-2-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]quinazolin-4-yl]amino]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 171414023 |
| Molecular Formula | C31H37N5O2 |
| Molecular Weight | 511.67 g/mol |
| Exact Mass | 511.29 |
| IUPAC Name | N-[2-[[7-(1,2,3,3a,4,8b-hexahydrocyclopenta[a]inden-8-yl)-2-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]quinazolin-4-yl]amino]ethyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCNc1nc(OC[C@@H]2CCCN2C)nc2cc(-c3cccc4c3C3CCCC3C4)ccc12 |
| InChI | InChI=1S/C31H37N5O2/c1-3-28(37)32-14-15-33-30-26-13-12-21(25-11-5-8-22-17-20-7-4-10-24(20)29(22)25)18-27(26)34-31(35-30)38-19-23-9-6-16-36(23)2/h3,5,8,11-13,18,20,23-24H,1,4,6-7,9-10,14-17,19H2,2H3,(H,32,37)(H,33,34,35)/t20?,23-,24?/m0/s1 |
| InChIKey | FNGVTBDVJKNRCB-GWHCDVRWSA-N |
| XLogP | 4.92 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.67 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|