C27H26F3N5O2S — CID 171412729
N-[2-[[7-(2,3-difluoro-1-benzothiophen-7-yl)-8-fluoro-2-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]quinazolin-4-yl]amino]ethyl]prop-2-enamide (PubChem CID 171412729) has the molecular formula C27H26F3N5O2S and a molecular weight of 541.60 g/mol. Its IUPAC name is N-[2-[[7-(2,3-difluoro-1-benzothiophen-7-yl)-8-fluoro-2-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]quinazolin-4-yl]amino]ethyl]prop-2-enamide.
| Compound Name | N-[2-[[7-(2,3-difluoro-1-benzothiophen-7-yl)-8-fluoro-2-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]quinazolin-4-yl]amino]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 171412729 |
| Molecular Formula | C27H26F3N5O2S |
| Molecular Weight | 541.60 g/mol |
| Exact Mass | 541.18 |
| IUPAC Name | N-[2-[[7-(2,3-difluoro-1-benzothiophen-7-yl)-8-fluoro-2-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]quinazolin-4-yl]amino]ethyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCNc1nc(OC[C@@H]2CCCN2C)nc2c(F)c(-c3cccc4c(F)c(F)sc34)ccc12 |
| InChI | InChI=1S/C27H26F3N5O2S/c1-3-20(36)31-11-12-32-26-19-10-9-16(17-7-4-8-18-22(29)25(30)38-24(17)18)21(28)23(19)33-27(34-26)37-14-15-6-5-13-35(15)2/h3-4,7-10,15H,1,5-6,11-14H2,2H3,(H,31,36)(H,32,33,34)/t15-/m0/s1 |
| InChIKey | DRZRWAJEVAKYSQ-HNNXBMFYSA-N |
| XLogP | 5.12 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.60 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|