C27H26F3N5O2S — CID 171412664
2-fluoro-N-[2-[[6-fluoro-7-(3-fluoro-1-benzothiophen-7-yl)-2-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]quinazolin-4-yl]amino]ethyl]prop-2-enamide (PubChem CID 171412664) has the molecular formula C27H26F3N5O2S and a molecular weight of 541.60 g/mol. Its IUPAC name is 2-fluoro-N-[2-[[6-fluoro-7-(3-fluoro-1-benzothiophen-7-yl)-2-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]quinazolin-4-yl]amino]ethyl]prop-2-enamide.
| Compound Name | 2-fluoro-N-[2-[[6-fluoro-7-(3-fluoro-1-benzothiophen-7-yl)-2-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]quinazolin-4-yl]amino]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 171412664 |
| Molecular Formula | C27H26F3N5O2S |
| Molecular Weight | 541.60 g/mol |
| Exact Mass | 541.18 |
| IUPAC Name | 2-fluoro-N-[2-[[6-fluoro-7-(3-fluoro-1-benzothiophen-7-yl)-2-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]quinazolin-4-yl]amino]ethyl]prop-2-enamide |
| SMILES | C=C(F)C(=O)NCCNc1nc(OC[C@@H]2CCCN2C)nc2cc(-c3cccc4c(F)csc34)c(F)cc12 |
| InChI | InChI=1S/C27H26F3N5O2S/c1-15(28)26(36)32-9-8-31-25-20-11-21(29)19(17-6-3-7-18-22(30)14-38-24(17)18)12-23(20)33-27(34-25)37-13-16-5-4-10-35(16)2/h3,6-7,11-12,14,16H,1,4-5,8-10,13H2,2H3,(H,32,36)(H,31,33,34)/t16-/m0/s1 |
| InChIKey | SFQOHBWQEVERDZ-INIZCTEOSA-N |
| XLogP | 5.27 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.60 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|