C29H33ClFN5O2 — CID 171413158
N-[2-[[6-chloro-8-fluoro-7-(2-methyl-2,3-dihydro-1H-inden-4-yl)-2-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]quinazolin-4-yl]amino]ethyl]prop-2-enamide (PubChem CID 171413158) has the molecular formula C29H33ClFN5O2 and a molecular weight of 538.07 g/mol. Its IUPAC name is N-[2-[[6-chloro-8-fluoro-7-(2-methyl-2,3-dihydro-1H-inden-4-yl)-2-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]quinazolin-4-yl]amino]ethyl]prop-2-enamide.
| Compound Name | N-[2-[[6-chloro-8-fluoro-7-(2-methyl-2,3-dihydro-1H-inden-4-yl)-2-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]quinazolin-4-yl]amino]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 171413158 |
| Molecular Formula | C29H33ClFN5O2 |
| Molecular Weight | 538.07 g/mol |
| Exact Mass | 537.23 |
| IUPAC Name | N-[2-[[6-chloro-8-fluoro-7-(2-methyl-2,3-dihydro-1H-inden-4-yl)-2-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]quinazolin-4-yl]amino]ethyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCNc1nc(OC[C@@H]2CCCN2C)nc2c(F)c(-c3cccc4c3CC(C)C4)c(Cl)cc12 |
| InChI | InChI=1S/C29H33ClFN5O2/c1-4-24(37)32-10-11-33-28-22-15-23(30)25(20-9-5-7-18-13-17(2)14-21(18)20)26(31)27(22)34-29(35-28)38-16-19-8-6-12-36(19)3/h4-5,7,9,15,17,19H,1,6,8,10-14,16H2,2-3H3,(H,32,37)(H,33,34,35)/t17?,19-/m0/s1 |
| InChIKey | ONDSRJGWWIWEBT-NNBQYGFHSA-N |
| XLogP | 5.01 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.07 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|