C32H35ClFN5O2 — CID 167139638
1-[(1R)-6-[6-chloro-8-fluoro-2-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]-7-(5,6,7,8-tetrahydronaphthalen-1-yl)quinazolin-4-yl]-2,6-diazabicyclo[3.2.0]heptan-2-yl]prop-2-en-1-one (PubChem CID 167139638) has the molecular formula C32H35ClFN5O2 and a molecular weight of 576.12 g/mol. Its IUPAC name is 1-[(1R)-6-[6-chloro-8-fluoro-2-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]-7-(5,6,7,8-tetrahydronaphthalen-1-yl)quinazolin-4-yl]-2,6-diazabicyclo[3.2.0]heptan-2-yl]prop-2-en-1-one.
| Compound Name | 1-[(1R)-6-[6-chloro-8-fluoro-2-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]-7-(5,6,7,8-tetrahydronaphthalen-1-yl)quinazolin-4-yl]-2,6-diazabicyclo[3.2.0]heptan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 167139638 |
| Molecular Formula | C32H35ClFN5O2 |
| Molecular Weight | 576.12 g/mol |
| Exact Mass | 575.25 |
| IUPAC Name | 1-[(1R)-6-[6-chloro-8-fluoro-2-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]-7-(5,6,7,8-tetrahydronaphthalen-1-yl)quinazolin-4-yl]-2,6-diazabicyclo[3.2.0]heptan-2-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC2[C@H]1CN2c1nc(OC[C@@H]2CCCN2C)nc2c(F)c(-c3cccc4c3CCCC4)c(Cl)cc12 |
| InChI | InChI=1S/C32H35ClFN5O2/c1-3-27(40)38-15-13-25-26(38)17-39(25)31-23-16-24(33)28(22-12-6-9-19-8-4-5-11-21(19)22)29(34)30(23)35-32(36-31)41-18-20-10-7-14-37(20)2/h3,6,9,12,16,20,25-26H,1,4-5,7-8,10-11,13-15,17-18H2,2H3/t20-,25?,26+/m0/s1 |
| InChIKey | DDPJVZJBVSTWFZ-KDZUSJKDSA-N |
| XLogP | 5.42 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.12 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|