C32H36FN5O2 — CID 167140243
1-[(1R,5R)-6-[2-[[(2S,4R)-4-fluoro-1-methylpyrrolidin-2-yl]methoxy]-7-(5,6,7,8-tetrahydronaphthalen-1-yl)quinazolin-4-yl]-2,6-diazabicyclo[3.2.0]heptan-2-yl]prop-2-en-1-one (PubChem CID 167140243) has the molecular formula C32H36FN5O2 and a molecular weight of 541.67 g/mol. Its IUPAC name is 1-[(1R,5R)-6-[2-[[(2S,4R)-4-fluoro-1-methylpyrrolidin-2-yl]methoxy]-7-(5,6,7,8-tetrahydronaphthalen-1-yl)quinazolin-4-yl]-2,6-diazabicyclo[3.2.0]heptan-2-yl]prop-2-en-1-one.
| Compound Name | 1-[(1R,5R)-6-[2-[[(2S,4R)-4-fluoro-1-methylpyrrolidin-2-yl]methoxy]-7-(5,6,7,8-tetrahydronaphthalen-1-yl)quinazolin-4-yl]-2,6-diazabicyclo[3.2.0]heptan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 167140243 |
| Molecular Formula | C32H36FN5O2 |
| Molecular Weight | 541.67 g/mol |
| Exact Mass | 541.29 |
| IUPAC Name | 1-[(1R,5R)-6-[2-[[(2S,4R)-4-fluoro-1-methylpyrrolidin-2-yl]methoxy]-7-(5,6,7,8-tetrahydronaphthalen-1-yl)quinazolin-4-yl]-2,6-diazabicyclo[3.2.0]heptan-2-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC[C@@H]2[C@H]1CN2c1nc(OC[C@@H]2C[C@@H](F)CN2C)nc2cc(-c3cccc4c3CCCC4)ccc12 |
| InChI | InChI=1S/C32H36FN5O2/c1-3-30(39)37-14-13-28-29(37)18-38(28)31-26-12-11-21(25-10-6-8-20-7-4-5-9-24(20)25)15-27(26)34-32(35-31)40-19-23-16-22(33)17-36(23)2/h3,6,8,10-12,15,22-23,28-29H,1,4-5,7,9,13-14,16-19H2,2H3/t22-,23+,28-,29-/m1/s1 |
| InChIKey | UMNYNNUEIZKPSN-AVKZGCRPSA-N |
| XLogP | 4.57 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.67 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|