C33H37FN6O2 — CID 175982454
1-[(1R,5S)-6-[6-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-7-(5,6,7,8-tetrahydroisoquinolin-4-yl)quinazolin-4-yl]-2,6-diazabicyclo[3.2.0]heptan-2-yl]prop-2-en-1-one (PubChem CID 175982454) has the molecular formula C33H37FN6O2 and a molecular weight of 568.70 g/mol. Its IUPAC name is 1-[(1R,5S)-6-[6-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-7-(5,6,7,8-tetrahydroisoquinolin-4-yl)quinazolin-4-yl]-2,6-diazabicyclo[3.2.0]heptan-2-yl]prop-2-en-1-one.
| Compound Name | 1-[(1R,5S)-6-[6-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-7-(5,6,7,8-tetrahydroisoquinolin-4-yl)quinazolin-4-yl]-2,6-diazabicyclo[3.2.0]heptan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 175982454 |
| Molecular Formula | C33H37FN6O2 |
| Molecular Weight | 568.70 g/mol |
| Exact Mass | 568.30 |
| IUPAC Name | 1-[(1R,5S)-6-[6-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-7-(5,6,7,8-tetrahydroisoquinolin-4-yl)quinazolin-4-yl]-2,6-diazabicyclo[3.2.0]heptan-2-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC[C@H]2[C@H]1CN2c1nc(OCC23CCCN2CCC3)nc2cc(-c3cncc4c3CCCC4)c(F)cc12 |
| InChI | InChI=1S/C33H37FN6O2/c1-2-30(41)39-14-9-28-29(39)19-40(28)31-24-15-26(34)23(25-18-35-17-21-7-3-4-8-22(21)25)16-27(24)36-32(37-31)42-20-33-10-5-12-38(33)13-6-11-33/h2,15-18,28-29H,1,3-14,19-20H2/t28-,29+/m0/s1 |
| InChIKey | NYKNIWHBALFNLM-URLMMPGGSA-N |
| XLogP | 4.69 |
| TPSA | 74.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.70 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|