C33H31ClF2N6O2 — CID 175982469
1-[(1R,5S)-6-[7-(5-chloroisoquinolin-4-yl)-6,8-difluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-4-yl]-2,6-diazabicyclo[3.2.0]heptan-2-yl]prop-2-en-1-one (PubChem CID 175982469) has the molecular formula C33H31ClF2N6O2 and a molecular weight of 617.10 g/mol. Its IUPAC name is 1-[(1R,5S)-6-[7-(5-chloroisoquinolin-4-yl)-6,8-difluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-4-yl]-2,6-diazabicyclo[3.2.0]heptan-2-yl]prop-2-en-1-one.
| Compound Name | 1-[(1R,5S)-6-[7-(5-chloroisoquinolin-4-yl)-6,8-difluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-4-yl]-2,6-diazabicyclo[3.2.0]heptan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 175982469 |
| Molecular Formula | C33H31ClF2N6O2 |
| Molecular Weight | 617.10 g/mol |
| Exact Mass | 616.22 |
| IUPAC Name | 1-[(1R,5S)-6-[7-(5-chloroisoquinolin-4-yl)-6,8-difluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-4-yl]-2,6-diazabicyclo[3.2.0]heptan-2-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC[C@H]2[C@H]1CN2c1nc(OCC23CCCN2CCC3)nc2c(F)c(-c3cncc4cccc(Cl)c34)c(F)cc12 |
| InChI | InChI=1S/C33H31ClF2N6O2/c1-2-26(43)41-13-8-24-25(41)17-42(24)31-20-14-23(35)28(21-16-37-15-19-6-3-7-22(34)27(19)21)29(36)30(20)38-32(39-31)44-18-33-9-4-11-40(33)12-5-10-33/h2-3,6-7,14-16,24-25H,1,4-5,8-13,17-18H2/t24-,25+/m0/s1 |
| InChIKey | VWYRMWLVZKYDID-LOSJGSFVSA-N |
| XLogP | 5.76 |
| TPSA | 74.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.10 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|