C34H33ClFN5O2 — CID 169323497
1-[(1R)-6-[7-(8-chloronaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-4-yl]-2,6-diazabicyclo[3.2.0]heptan-2-yl]-2-fluoroprop-2-en-1-one (PubChem CID 169323497) has the molecular formula C34H33ClFN5O2 and a molecular weight of 598.12 g/mol. Its IUPAC name is 1-[(1R)-6-[7-(8-chloronaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-4-yl]-2,6-diazabicyclo[3.2.0]heptan-2-yl]-2-fluoroprop-2-en-1-one.
| Compound Name | 1-[(1R)-6-[7-(8-chloronaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-4-yl]-2,6-diazabicyclo[3.2.0]heptan-2-yl]-2-fluoroprop-2-en-1-one |
|---|---|
| PubChem CID | 169323497 |
| Molecular Formula | C34H33ClFN5O2 |
| Molecular Weight | 598.12 g/mol |
| Exact Mass | 597.23 |
| IUPAC Name | 1-[(1R)-6-[7-(8-chloronaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-4-yl]-2,6-diazabicyclo[3.2.0]heptan-2-yl]-2-fluoroprop-2-en-1-one |
| SMILES | C=C(F)C(=O)N1CCC2[C@H]1CN2c1nc(OCC23CCCN2CCC3)nc2cc(-c3cccc4cccc(Cl)c34)ccc12 |
| InChI | InChI=1S/C34H33ClFN5O2/c1-21(36)32(42)40-17-12-28-29(40)19-41(28)31-25-11-10-23(24-8-2-6-22-7-3-9-26(35)30(22)24)18-27(25)37-33(38-31)43-20-34-13-4-15-39(34)16-5-14-34/h2-3,6-11,18,28-29H,1,4-5,12-17,19-20H2/t28?,29-/m1/s1 |
| InChIKey | QUCROUZTBJAROS-YPJJGMIRSA-N |
| XLogP | 6.38 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.12 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|