C37H36ClN5O2 — CID 171413719
2-[7-(8-chloronaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-[(1R,5R)-2-prop-2-enoyl-2,6-diazabicyclo[3.2.0]heptan-6-yl]quinolin-3-yl]acetonitrile (PubChem CID 171413719) has the molecular formula C37H36ClN5O2 and a molecular weight of 618.18 g/mol. Its IUPAC name is 2-[7-(8-chloronaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-[(1R,5R)-2-prop-2-enoyl-2,6-diazabicyclo[3.2.0]heptan-6-yl]quinolin-3-yl]acetonitrile.
| Compound Name | 2-[7-(8-chloronaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-[(1R,5R)-2-prop-2-enoyl-2,6-diazabicyclo[3.2.0]heptan-6-yl]quinolin-3-yl]acetonitrile |
|---|---|
| PubChem CID | 171413719 |
| Molecular Formula | C37H36ClN5O2 |
| Molecular Weight | 618.18 g/mol |
| Exact Mass | 617.26 |
| IUPAC Name | 2-[7-(8-chloronaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-[(1R,5R)-2-prop-2-enoyl-2,6-diazabicyclo[3.2.0]heptan-6-yl]quinolin-3-yl]acetonitrile |
| SMILES | C=CC(=O)N1CC[C@@H]2[C@H]1CN2c1c(CC#N)c(OCC23CCCN2CCC3)nc2cc(-c3cccc4cccc(Cl)c34)ccc12 |
| InChI | InChI=1S/C37H36ClN5O2/c1-2-33(44)42-20-14-31-32(42)22-43(31)35-27-12-11-25(26-9-3-7-24-8-4-10-29(38)34(24)26)21-30(27)40-36(28(35)13-17-39)45-23-37-15-5-18-41(37)19-6-16-37/h2-4,7-12,21,31-32H,1,5-6,13-16,18-20,22-23H2/t31-,32-/m1/s1 |
| InChIKey | KJFPNOAODQHXEZ-ROJLCIKYSA-N |
| XLogP | 6.76 |
| TPSA | 72.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.18 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|