C36H33ClFN5O2 — CID 167140585
7-(8-chloronaphthalen-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-[(1R,5R)-2-prop-2-enoyl-2,6-diazabicyclo[3.2.0]heptan-6-yl]quinoline-3-carbonitrile (PubChem CID 167140585) has the molecular formula C36H33ClFN5O2 and a molecular weight of 622.14 g/mol. Its IUPAC name is 7-(8-chloronaphthalen-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-[(1R,5R)-2-prop-2-enoyl-2,6-diazabicyclo[3.2.0]heptan-6-yl]quinoline-3-carbonitrile.
| Compound Name | 7-(8-chloronaphthalen-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-[(1R,5R)-2-prop-2-enoyl-2,6-diazabicyclo[3.2.0]heptan-6-yl]quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 167140585 |
| Molecular Formula | C36H33ClFN5O2 |
| Molecular Weight | 622.14 g/mol |
| Exact Mass | 621.23 |
| IUPAC Name | 7-(8-chloronaphthalen-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-[(1R,5R)-2-prop-2-enoyl-2,6-diazabicyclo[3.2.0]heptan-6-yl]quinoline-3-carbonitrile |
| SMILES | C=CC(=O)N1CC[C@@H]2[C@H]1CN2c1c(C#N)c(OCC23CCCN2CCC3)nc2c(F)c(-c3cccc4cccc(Cl)c34)ccc12 |
| InChI | InChI=1S/C36H33ClFN5O2/c1-2-30(44)42-18-13-28-29(42)20-43(28)34-25-12-11-24(23-9-3-7-22-8-4-10-27(37)31(22)23)32(38)33(25)40-35(26(34)19-39)45-21-36-14-5-16-41(36)17-6-15-36/h2-4,7-12,28-29H,1,5-6,13-18,20-21H2/t28-,29-/m1/s1 |
| InChIKey | MQMGAOLQSUJCIV-FQLXRVMXSA-N |
| XLogP | 6.70 |
| TPSA | 72.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.14 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|