C34H35ClFN5O2 — CID 167139286
1-[(3S)-4-[7-(8-chloronaphthalen-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-4-yl]-3-methylpiperazin-1-yl]prop-2-en-1-one (PubChem CID 167139286) has the molecular formula C34H35ClFN5O2 and a molecular weight of 600.14 g/mol. Its IUPAC name is 1-[(3S)-4-[7-(8-chloronaphthalen-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-4-yl]-3-methylpiperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(3S)-4-[7-(8-chloronaphthalen-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-4-yl]-3-methylpiperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 167139286 |
| Molecular Formula | C34H35ClFN5O2 |
| Molecular Weight | 600.14 g/mol |
| Exact Mass | 599.25 |
| IUPAC Name | 1-[(3S)-4-[7-(8-chloronaphthalen-1-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-4-yl]-3-methylpiperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(c2nc(OCC34CCCN3CCC4)nc3c(F)c(-c4cccc5cccc(Cl)c45)ccc23)[C@@H](C)C1 |
| InChI | InChI=1S/C34H35ClFN5O2/c1-3-28(42)39-18-19-41(22(2)20-39)32-26-13-12-25(24-10-4-8-23-9-5-11-27(35)29(23)24)30(36)31(26)37-33(38-32)43-21-34-14-6-16-40(34)17-7-15-34/h3-5,8-13,22H,1,6-7,14-21H2,2H3/t22-/m0/s1 |
| InChIKey | IHJWGGOLIGJSCZ-QFIPXVFZSA-N |
| XLogP | 6.47 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.14 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|