C35H37F2N5O2 — CID 171611904
1-[(3R)-4-[8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-7-(8-methylnaphthalen-1-yl)quinazolin-4-yl]-3-methylpiperazin-1-yl]prop-2-en-1-one (PubChem CID 171611904) has the molecular formula C35H37F2N5O2 and a molecular weight of 597.71 g/mol. Its IUPAC name is 1-[(3R)-4-[8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-7-(8-methylnaphthalen-1-yl)quinazolin-4-yl]-3-methylpiperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(3R)-4-[8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-7-(8-methylnaphthalen-1-yl)quinazolin-4-yl]-3-methylpiperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 171611904 |
| Molecular Formula | C35H37F2N5O2 |
| Molecular Weight | 597.71 g/mol |
| Exact Mass | 597.29 |
| IUPAC Name | 1-[(3R)-4-[8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-7-(8-methylnaphthalen-1-yl)quinazolin-4-yl]-3-methylpiperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(c2nc(OC[C@@]34CCCN3C[C@H](F)C4)nc3c(F)c(-c4cccc5cccc(C)c45)ccc23)[C@H](C)C1 |
| InChI | InChI=1S/C35H37F2N5O2/c1-4-29(43)40-16-17-42(23(3)19-40)33-28-13-12-27(26-11-6-10-24-9-5-8-22(2)30(24)26)31(37)32(28)38-34(39-33)44-21-35-14-7-15-41(35)20-25(36)18-35/h4-6,8-13,23,25H,1,7,14-21H2,2-3H3/t23-,25-,35+/m1/s1 |
| InChIKey | GLFSBWCJIQYTDP-UMUYATIVSA-N |
| XLogP | 6.08 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.71 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|