C33H36F2N6O3 — CID 167510653
1-[(3R)-4-[7-(2-cyclopropyl-6-nitrosophenyl)-6-fluoro-2-[[(2R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]quinazolin-4-yl]-3-methylpiperazin-1-yl]prop-2-en-1-one (PubChem CID 167510653) has the molecular formula C33H36F2N6O3 and a molecular weight of 602.69 g/mol. Its IUPAC name is 1-[(3R)-4-[7-(2-cyclopropyl-6-nitrosophenyl)-6-fluoro-2-[[(2R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]quinazolin-4-yl]-3-methylpiperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(3R)-4-[7-(2-cyclopropyl-6-nitrosophenyl)-6-fluoro-2-[[(2R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]quinazolin-4-yl]-3-methylpiperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 167510653 |
| Molecular Formula | C33H36F2N6O3 |
| Molecular Weight | 602.69 g/mol |
| Exact Mass | 602.28 |
| IUPAC Name | 1-[(3R)-4-[7-(2-cyclopropyl-6-nitrosophenyl)-6-fluoro-2-[[(2R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]quinazolin-4-yl]-3-methylpiperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(c2nc(OCC34CCCN3C[C@H](F)C4)nc3cc(-c4c(N=O)cccc4C4CC4)c(F)cc23)[C@H](C)C1 |
| InChI | InChI=1S/C33H36F2N6O3/c1-3-29(42)39-12-13-41(20(2)17-39)31-25-14-26(35)24(30-23(21-8-9-21)6-4-7-27(30)38-43)15-28(25)36-32(37-31)44-19-33-10-5-11-40(33)18-22(34)16-33/h3-4,6-7,14-15,20-22H,1,5,8-13,16-19H2,2H3/t20-,22-,33?/m1/s1 |
| InChIKey | BGTNAGTWMDNSFY-LLTIVYCOSA-N |
| XLogP | 5.89 |
| TPSA | 91.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.69 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|