C33H33F2N5O — CID 170793451
7-(8-ethynylnaphthalen-1-yl)-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-4-[(2S)-2-methylpiperazin-1-yl]quinazoline (PubChem CID 170793451) has the molecular formula C33H33F2N5O and a molecular weight of 553.66 g/mol. Its IUPAC name is 7-(8-ethynylnaphthalen-1-yl)-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-4-[(2S)-2-methylpiperazin-1-yl]quinazoline.
| Compound Name | 7-(8-ethynylnaphthalen-1-yl)-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-4-[(2S)-2-methylpiperazin-1-yl]quinazoline |
|---|---|
| PubChem CID | 170793451 |
| Molecular Formula | C33H33F2N5O |
| Molecular Weight | 553.66 g/mol |
| Exact Mass | 553.27 |
| IUPAC Name | 7-(8-ethynylnaphthalen-1-yl)-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]-4-[(2S)-2-methylpiperazin-1-yl]quinazoline |
| SMILES | C#Cc1cccc2cccc(-c3ccc4c(N5CCNC[C@@H]5C)nc(OC[C@@]56CCCN5C[C@H](F)C6)nc4c3F)c12 |
| InChI | InChI=1S/C33H33F2N5O/c1-3-22-7-4-8-23-9-5-10-25(28(22)23)26-11-12-27-30(29(26)35)37-32(38-31(27)40-16-14-36-18-21(40)2)41-20-33-13-6-15-39(33)19-24(34)17-33/h1,4-5,7-12,21,24,36H,6,13-20H2,2H3/t21-,24+,33-/m0/s1 |
| InChIKey | YYRKHMNYBCLEJX-ZMRVZMAOSA-N |
| XLogP | 5.32 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.66 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|