C33H29F4N5O3 — CID 175928439
2-[7-(8-ethynyl-7-fluoronaphthalen-1-yl)-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]quinazolin-4-yl]-6-fluoropiperazine-1-carboxylic acid (PubChem CID 175928439) has the molecular formula C33H29F4N5O3 and a molecular weight of 619.62 g/mol. Its IUPAC name is 2-[7-(8-ethynyl-7-fluoronaphthalen-1-yl)-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]quinazolin-4-yl]-6-fluoropiperazine-1-carboxylic acid.
| Compound Name | 2-[7-(8-ethynyl-7-fluoronaphthalen-1-yl)-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]quinazolin-4-yl]-6-fluoropiperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 175928439 |
| Molecular Formula | C33H29F4N5O3 |
| Molecular Weight | 619.62 g/mol |
| Exact Mass | 619.22 |
| IUPAC Name | 2-[7-(8-ethynyl-7-fluoronaphthalen-1-yl)-8-fluoro-2-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]quinazolin-4-yl]-6-fluoropiperazine-1-carboxylic acid |
| SMILES | C#Cc1c(F)ccc2cccc(-c3ccc4c(C5CNCC(F)N5C(=O)O)nc(OC[C@@]56CCCN5C[C@H](F)C6)nc4c3F)c12 |
| InChI | InChI=1S/C33H29F4N5O3/c1-2-20-24(35)10-7-18-5-3-6-21(27(18)20)22-8-9-23-29(25-14-38-15-26(36)42(25)32(43)44)39-31(40-30(23)28(22)37)45-17-33-11-4-12-41(33)16-19(34)13-33/h1,3,5-10,19,25-26,38H,4,11-17H2,(H,43,44)/t19-,25?,26?,33+/m1/s1 |
| InChIKey | SVJCIQBBNNOTSR-DABAEOHISA-N |
| XLogP | 5.58 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.62 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|