C34H34ClN7O2 — CID 167140641
2-[(2S)-4-[7-(5-chloroisoquinolin-4-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-4-yl]-1-prop-2-enoylpiperazin-2-yl]acetonitrile (PubChem CID 167140641) has the molecular formula C34H34ClN7O2 and a molecular weight of 608.15 g/mol. Its IUPAC name is 2-[(2S)-4-[7-(5-chloroisoquinolin-4-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-4-yl]-1-prop-2-enoylpiperazin-2-yl]acetonitrile.
| Compound Name | 2-[(2S)-4-[7-(5-chloroisoquinolin-4-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-4-yl]-1-prop-2-enoylpiperazin-2-yl]acetonitrile |
|---|---|
| PubChem CID | 167140641 |
| Molecular Formula | C34H34ClN7O2 |
| Molecular Weight | 608.15 g/mol |
| Exact Mass | 607.25 |
| IUPAC Name | 2-[(2S)-4-[7-(5-chloroisoquinolin-4-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-4-yl]-1-prop-2-enoylpiperazin-2-yl]acetonitrile |
| SMILES | C=CC(=O)N1CCN(c2nc(OCC34CCCN3CCC4)nc3cc(-c4cncc5cccc(Cl)c45)ccc23)C[C@@H]1CC#N |
| InChI | InChI=1S/C34H34ClN7O2/c1-2-30(43)42-17-16-40(21-25(42)10-13-36)32-26-9-8-23(27-20-37-19-24-6-3-7-28(35)31(24)27)18-29(26)38-33(39-32)44-22-34-11-4-14-41(34)15-5-12-34/h2-3,6-9,18-20,25H,1,4-5,10-12,14-17,21-22H2/t25-/m0/s1 |
| InChIKey | HTDRXDPAEPXWNZ-VWLOTQADSA-N |
| XLogP | 5.62 |
| TPSA | 98.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.15 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|