C33H33ClN8O2 — CID 171413501
1-[(2R)-4-[7-(5-chloroisoquinolin-4-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[2,3-d]pyrimidin-4-yl]-2-(isocyanomethyl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 171413501) has the molecular formula C33H33ClN8O2 and a molecular weight of 609.13 g/mol. Its IUPAC name is 1-[(2R)-4-[7-(5-chloroisoquinolin-4-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[2,3-d]pyrimidin-4-yl]-2-(isocyanomethyl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(2R)-4-[7-(5-chloroisoquinolin-4-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[2,3-d]pyrimidin-4-yl]-2-(isocyanomethyl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 171413501 |
| Molecular Formula | C33H33ClN8O2 |
| Molecular Weight | 609.13 g/mol |
| Exact Mass | 608.24 |
| IUPAC Name | 1-[(2R)-4-[7-(5-chloroisoquinolin-4-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[2,3-d]pyrimidin-4-yl]-2-(isocyanomethyl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | [C-]#[N+]C[C@H]1CN(c2nc(OCC34CCCN3CCC4)nc3nc(-c4cncc5cccc(Cl)c45)ccc23)CCN1C(=O)C=C |
| InChI | InChI=1S/C33H33ClN8O2/c1-3-28(43)42-16-15-40(20-23(42)18-35-2)31-24-9-10-27(25-19-36-17-22-7-4-8-26(34)29(22)25)37-30(24)38-32(39-31)44-21-33-11-5-13-41(33)14-6-12-33/h3-4,7-10,17,19,23H,1,5-6,11-16,18,20-21H2/t23-/m0/s1 |
| InChIKey | QHXHMDHUSIXHDN-QHCPKHFHSA-N |
| XLogP | 5.02 |
| TPSA | 91.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.13 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|