C33H33FN6O2S — CID 171413532
1-[(2R)-4-[7-(1-benzothiophen-7-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-4-yl]-2-(isocyanomethyl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 171413532) has the molecular formula C33H33FN6O2S and a molecular weight of 596.73 g/mol. Its IUPAC name is 1-[(2R)-4-[7-(1-benzothiophen-7-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-4-yl]-2-(isocyanomethyl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(2R)-4-[7-(1-benzothiophen-7-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-4-yl]-2-(isocyanomethyl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 171413532 |
| Molecular Formula | C33H33FN6O2S |
| Molecular Weight | 596.73 g/mol |
| Exact Mass | 596.24 |
| IUPAC Name | 1-[(2R)-4-[7-(1-benzothiophen-7-yl)-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-4-yl]-2-(isocyanomethyl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | [C-]#[N+]C[C@H]1CN(c2nc(OCC34CCCN3CCC4)nc3c(F)c(-c4cccc5ccsc45)ccc23)CCN1C(=O)C=C |
| InChI | InChI=1S/C33H33FN6O2S/c1-3-27(41)40-17-16-38(20-23(40)19-35-2)31-26-10-9-24(25-8-4-7-22-11-18-43-30(22)25)28(34)29(26)36-32(37-31)42-21-33-12-5-14-39(33)15-6-13-33/h3-4,7-11,18,23H,1,5-6,12-17,19-21H2/t23-/m0/s1 |
| InChIKey | KROMNVWEYOQWAU-QHCPKHFHSA-N |
| XLogP | 5.78 |
| TPSA | 66.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.73 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|