C38H37FN6O2 — CID 171413526
1-[(2R)-4-[7-(8-ethynylnaphthalen-1-yl)-8-fluoro-2-[[1-(pyrrolidin-1-ylmethyl)cyclopropyl]methoxy]quinazolin-4-yl]-2-(isocyanomethyl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 171413526) has the molecular formula C38H37FN6O2 and a molecular weight of 628.75 g/mol. Its IUPAC name is 1-[(2R)-4-[7-(8-ethynylnaphthalen-1-yl)-8-fluoro-2-[[1-(pyrrolidin-1-ylmethyl)cyclopropyl]methoxy]quinazolin-4-yl]-2-(isocyanomethyl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(2R)-4-[7-(8-ethynylnaphthalen-1-yl)-8-fluoro-2-[[1-(pyrrolidin-1-ylmethyl)cyclopropyl]methoxy]quinazolin-4-yl]-2-(isocyanomethyl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 171413526 |
| Molecular Formula | C38H37FN6O2 |
| Molecular Weight | 628.75 g/mol |
| Exact Mass | 628.30 |
| IUPAC Name | 1-[(2R)-4-[7-(8-ethynylnaphthalen-1-yl)-8-fluoro-2-[[1-(pyrrolidin-1-ylmethyl)cyclopropyl]methoxy]quinazolin-4-yl]-2-(isocyanomethyl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | [C-]#[N+]C[C@H]1CN(c2nc(OCC3(CN4CCCC4)CC3)nc3c(F)c(-c4cccc5cccc(C#C)c45)ccc23)CCN1C(=O)C=C |
| InChI | InChI=1S/C38H37FN6O2/c1-4-26-10-8-11-27-12-9-13-29(33(26)27)30-14-15-31-35(34(30)39)41-37(47-25-38(16-17-38)24-43-18-6-7-19-43)42-36(31)44-20-21-45(32(46)5-2)28(23-44)22-40-3/h1,5,8-15,28H,2,6-7,16-25H2/t28-/m0/s1 |
| InChIKey | ZNIHAHMATAOMOE-NDEPHWFRSA-N |
| XLogP | 5.95 |
| TPSA | 66.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.75 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|