C32H31F2N7O2S — CID 171413399
1-[(2R)-4-[7-(1,3-benzothiazol-4-yl)-8-fluoro-2-[[(2R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]quinazolin-4-yl]-2-(isocyanomethyl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 171413399) has the molecular formula C32H31F2N7O2S and a molecular weight of 615.71 g/mol. Its IUPAC name is 1-[(2R)-4-[7-(1,3-benzothiazol-4-yl)-8-fluoro-2-[[(2R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]quinazolin-4-yl]-2-(isocyanomethyl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(2R)-4-[7-(1,3-benzothiazol-4-yl)-8-fluoro-2-[[(2R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]quinazolin-4-yl]-2-(isocyanomethyl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 171413399 |
| Molecular Formula | C32H31F2N7O2S |
| Molecular Weight | 615.71 g/mol |
| Exact Mass | 615.22 |
| IUPAC Name | 1-[(2R)-4-[7-(1,3-benzothiazol-4-yl)-8-fluoro-2-[[(2R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]quinazolin-4-yl]-2-(isocyanomethyl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | [C-]#[N+]C[C@H]1CN(c2nc(OCC34CCCN3C[C@H](F)C4)nc3c(F)c(-c4cccc5scnc45)ccc23)CCN1C(=O)C=C |
| InChI | InChI=1S/C32H31F2N7O2S/c1-3-26(42)41-13-12-39(17-21(41)15-35-2)30-24-9-8-22(23-6-4-7-25-28(23)36-19-44-25)27(34)29(24)37-31(38-30)43-18-32-10-5-11-40(32)16-20(33)14-32/h3-4,6-9,19-21H,1,5,10-18H2/t20-,21+,32?/m1/s1 |
| InChIKey | ACRFVEAHGIUGQD-IJONOHDLSA-N |
| XLogP | 5.12 |
| TPSA | 79.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.71 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|