C33H33ClFN5O2 — CID 171552471
1-[4-[7-(8-chloronaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-1,5-naphthyridin-4-yl]piperazin-1-yl]-2-fluoroprop-2-en-1-one (PubChem CID 171552471) has the molecular formula C33H33ClFN5O2 and a molecular weight of 586.11 g/mol. Its IUPAC name is 1-[4-[7-(8-chloronaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-1,5-naphthyridin-4-yl]piperazin-1-yl]-2-fluoroprop-2-en-1-one.
| Compound Name | 1-[4-[7-(8-chloronaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-1,5-naphthyridin-4-yl]piperazin-1-yl]-2-fluoroprop-2-en-1-one |
|---|---|
| PubChem CID | 171552471 |
| Molecular Formula | C33H33ClFN5O2 |
| Molecular Weight | 586.11 g/mol |
| Exact Mass | 585.23 |
| IUPAC Name | 1-[4-[7-(8-chloronaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-1,5-naphthyridin-4-yl]piperazin-1-yl]-2-fluoroprop-2-en-1-one |
| SMILES | C=C(F)C(=O)N1CCN(c2cc(OCC34CCCN3CCC4)nc3cc(-c4cccc5cccc(Cl)c45)cnc23)CC1 |
| InChI | InChI=1S/C33H33ClFN5O2/c1-22(35)32(41)39-16-14-38(15-17-39)28-19-29(42-21-33-10-4-12-40(33)13-5-11-33)37-27-18-24(20-36-31(27)28)25-8-2-6-23-7-3-9-26(34)30(23)25/h2-3,6-9,18-20H,1,4-5,10-17,21H2 |
| InChIKey | QZOSJLUKGQARSP-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.11 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|