C34H41ClN6O — CID 171552541
acetonitrile;7-(8-chloronaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-piperazin-1-yl-1,5-naphthyridine;ethane (PubChem CID 171552541) has the molecular formula C34H41ClN6O and a molecular weight of 585.20 g/mol. Its IUPAC name is acetonitrile;7-(8-chloronaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-piperazin-1-yl-1,5-naphthyridine;ethane.
| Compound Name | acetonitrile;7-(8-chloronaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-piperazin-1-yl-1,5-naphthyridine;ethane |
|---|---|
| PubChem CID | 171552541 |
| Molecular Formula | C34H41ClN6O |
| Molecular Weight | 585.20 g/mol |
| Exact Mass | 584.30 |
| IUPAC Name | acetonitrile;7-(8-chloronaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-piperazin-1-yl-1,5-naphthyridine;ethane |
| SMILES | CC.CC#N.Clc1cccc2cccc(-c3cnc4c(N5CCNCC5)cc(OCC56CCCN5CCC6)nc4c3)c12 |
| InChI | InChI=1S/C30H32ClN5O.C2H3N.C2H6/c31-24-8-2-6-21-5-1-7-23(28(21)24)22-17-25-29(33-19-22)26(35-15-11-32-12-16-35)18-27(34-25)37-20-30-9-3-13-36(30)14-4-10-30;1-2-3;1-2/h1-2,5-8,17-19,32H,3-4,9-16,20H2;1H3;1-2H3 |
| InChIKey | KPHJZHCFCKKZNG-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 77.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.20 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |