C27H26N4O2 — CID 171552452
1-[4-[2-methoxy-7-(8-methylnaphthalen-1-yl)-1,5-naphthyridin-4-yl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 171552452) has the molecular formula C27H26N4O2 and a molecular weight of 438.53 g/mol. Its IUPAC name is 1-[4-[2-methoxy-7-(8-methylnaphthalen-1-yl)-1,5-naphthyridin-4-yl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[2-methoxy-7-(8-methylnaphthalen-1-yl)-1,5-naphthyridin-4-yl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 171552452 |
| Molecular Formula | C27H26N4O2 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | 1-[4-[2-methoxy-7-(8-methylnaphthalen-1-yl)-1,5-naphthyridin-4-yl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(c2cc(OC)nc3cc(-c4cccc5cccc(C)c45)cnc23)CC1 |
| InChI | InChI=1S/C27H26N4O2/c1-4-25(32)31-13-11-30(12-14-31)23-16-24(33-3)29-22-15-20(17-28-27(22)23)21-10-6-9-19-8-5-7-18(2)26(19)21/h4-10,15-17H,1,11-14H2,2-3H3 |
| InChIKey | GHLJRESEKWTPGR-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|