C28H27FN4O2 — CID 171552486
1-[4-[7-(8-ethylnaphthalen-1-yl)-2-methoxy-1,5-naphthyridin-4-yl]piperazin-1-yl]-2-fluoroprop-2-en-1-one (PubChem CID 171552486) has the molecular formula C28H27FN4O2 and a molecular weight of 470.55 g/mol. Its IUPAC name is 1-[4-[7-(8-ethylnaphthalen-1-yl)-2-methoxy-1,5-naphthyridin-4-yl]piperazin-1-yl]-2-fluoroprop-2-en-1-one.
| Compound Name | 1-[4-[7-(8-ethylnaphthalen-1-yl)-2-methoxy-1,5-naphthyridin-4-yl]piperazin-1-yl]-2-fluoroprop-2-en-1-one |
|---|---|
| PubChem CID | 171552486 |
| Molecular Formula | C28H27FN4O2 |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | 1-[4-[7-(8-ethylnaphthalen-1-yl)-2-methoxy-1,5-naphthyridin-4-yl]piperazin-1-yl]-2-fluoroprop-2-en-1-one |
| SMILES | C=C(F)C(=O)N1CCN(c2cc(OC)nc3cc(-c4cccc5cccc(CC)c45)cnc23)CC1 |
| InChI | InChI=1S/C28H27FN4O2/c1-4-19-7-5-8-20-9-6-10-22(26(19)20)21-15-23-27(30-17-21)24(16-25(31-23)35-3)32-11-13-33(14-12-32)28(34)18(2)29/h5-10,15-17H,2,4,11-14H2,1,3H3 |
| InChIKey | BYRIXAOIKJYRQA-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|