C32H34ClN5O2 — CID 174147723
4-[5-(3-azabicyclo[3.2.1]octan-3-yl)-7-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-2-yl]-5-chloronaphthalen-2-ol (PubChem CID 174147723) has the molecular formula C32H34ClN5O2 and a molecular weight of 556.11 g/mol. Its IUPAC name is 4-[5-(3-azabicyclo[3.2.1]octan-3-yl)-7-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-2-yl]-5-chloronaphthalen-2-ol.
| Compound Name | 4-[5-(3-azabicyclo[3.2.1]octan-3-yl)-7-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-2-yl]-5-chloronaphthalen-2-ol |
|---|---|
| PubChem CID | 174147723 |
| Molecular Formula | C32H34ClN5O2 |
| Molecular Weight | 556.11 g/mol |
| Exact Mass | 555.24 |
| IUPAC Name | 4-[5-(3-azabicyclo[3.2.1]octan-3-yl)-7-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidin-2-yl]-5-chloronaphthalen-2-ol |
| SMILES | Oc1cc(-c2ncc3c(N4CC5CCC(C5)C4)nc(OCC45CCCN4CCC5)cc3n2)c2c(Cl)cccc2c1 |
| InChI | InChI=1S/C32H34ClN5O2/c33-26-5-1-4-22-13-23(39)14-24(29(22)26)30-34-16-25-27(35-30)15-28(40-19-32-8-2-10-38(32)11-3-9-32)36-31(25)37-17-20-6-7-21(12-20)18-37/h1,4-5,13-16,20-21,39H,2-3,6-12,17-19H2 |
| InChIKey | JSHROQBNVRROCH-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.11 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |