C31H33ClN6O3 — CID 170362425
7-(8-chloro-3-hydroxynaphthalen-1-yl)-4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[3,4-d]pyrimidin-6-one (PubChem CID 170362425) has the molecular formula C31H33ClN6O3 and a molecular weight of 573.10 g/mol. Its IUPAC name is 7-(8-chloro-3-hydroxynaphthalen-1-yl)-4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[3,4-d]pyrimidin-6-one.
| Compound Name | 7-(8-chloro-3-hydroxynaphthalen-1-yl)-4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[3,4-d]pyrimidin-6-one |
|---|---|
| PubChem CID | 170362425 |
| Molecular Formula | C31H33ClN6O3 |
| Molecular Weight | 573.10 g/mol |
| Exact Mass | 572.23 |
| IUPAC Name | 7-(8-chloro-3-hydroxynaphthalen-1-yl)-4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[3,4-d]pyrimidin-6-one |
| SMILES | O=c1cc2c(N3CC4CCC(C3)N4)nc(OCC34CCCN3CCC4)nc2cn1-c1cc(O)cc2cccc(Cl)c12 |
| InChI | InChI=1S/C31H33ClN6O3/c32-24-5-1-4-19-12-22(39)13-26(28(19)24)38-17-25-23(14-27(38)40)29(36-15-20-6-7-21(16-36)33-20)35-30(34-25)41-18-31-8-2-10-37(31)11-3-9-31/h1,4-5,12-14,17,20-21,33,39H,2-3,6-11,15-16,18H2 |
| InChIKey | JUNQALMOJFACEW-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 95.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.10 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |