C31H34Cl2N6O — CID 168912492
7-(8-chloronaphthalen-1-yl)-4-[(1S,5R)-3,8-diazabicyclo[3.2.1]octan-3-yl]-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[3,2-d]pyrimidine;hydrochloride (PubChem CID 168912492) has the molecular formula C31H34Cl2N6O and a molecular weight of 577.56 g/mol. Its IUPAC name is 7-(8-chloronaphthalen-1-yl)-4-[(1S,5R)-3,8-diazabicyclo[3.2.1]octan-3-yl]-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[3,2-d]pyrimidine;hydrochloride.
| Compound Name | 7-(8-chloronaphthalen-1-yl)-4-[(1S,5R)-3,8-diazabicyclo[3.2.1]octan-3-yl]-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[3,2-d]pyrimidine;hydrochloride |
|---|---|
| PubChem CID | 168912492 |
| Molecular Formula | C31H34Cl2N6O |
| Molecular Weight | 577.56 g/mol |
| Exact Mass | 576.22 |
| IUPAC Name | 7-(8-chloronaphthalen-1-yl)-4-[(1S,5R)-3,8-diazabicyclo[3.2.1]octan-3-yl]-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[3,2-d]pyrimidine;hydrochloride |
| SMILES | Cl.Clc1cccc2cccc(-c3cnc4c(N5C[C@H]6CC[C@@H](C5)N6)nc(OCC56CCCN5CCC6)nc4c3)c12 |
| InChI | InChI=1S/C31H33ClN6O.ClH/c32-25-8-2-6-20-5-1-7-24(27(20)25)21-15-26-28(33-16-21)29(37-17-22-9-10-23(18-37)34-22)36-30(35-26)39-19-31-11-3-13-38(31)14-4-12-31;/h1-2,5-8,15-16,22-23,34H,3-4,9-14,17-19H2;1H/t22-,23+; |
| InChIKey | OIDXNBIYMRLUGW-ZJXXCOCUSA-N |
| XLogP | 5.87 |
| TPSA | 66.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.56 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |