C32H38ClN5O2 — CID 167179728
4-[4-(8-azabicyclo[3.2.1]octan-3-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]-5-chloronaphthalen-2-ol (PubChem CID 167179728) has the molecular formula C32H38ClN5O2 and a molecular weight of 560.14 g/mol. Its IUPAC name is 4-[4-(8-azabicyclo[3.2.1]octan-3-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]-5-chloronaphthalen-2-ol.
| Compound Name | 4-[4-(8-azabicyclo[3.2.1]octan-3-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]-5-chloronaphthalen-2-ol |
|---|---|
| PubChem CID | 167179728 |
| Molecular Formula | C32H38ClN5O2 |
| Molecular Weight | 560.14 g/mol |
| Exact Mass | 559.27 |
| IUPAC Name | 4-[4-(8-azabicyclo[3.2.1]octan-3-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]-5-chloronaphthalen-2-ol |
| SMILES | Oc1cc(N2CCc3c(nc(OCC45CCCN4CCC5)nc3C3CC4CCC(C3)N4)C2)c2c(Cl)cccc2c1 |
| InChI | InChI=1S/C32H38ClN5O2/c33-26-5-1-4-20-16-24(39)17-28(29(20)26)37-13-8-25-27(18-37)35-31(40-19-32-9-2-11-38(32)12-3-10-32)36-30(25)21-14-22-6-7-23(15-21)34-22/h1,4-5,16-17,21-23,34,39H,2-3,6-15,18-19H2 |
| InChIKey | QBQHVUOXORPPMS-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 73.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.14 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |