C34H38FN5O — CID 167179754
4-[(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl]-7-(8-ethynyl-7-fluoronaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine (PubChem CID 167179754) has the molecular formula C34H38FN5O and a molecular weight of 551.71 g/mol. Its IUPAC name is 4-[(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl]-7-(8-ethynyl-7-fluoronaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine.
| Compound Name | 4-[(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl]-7-(8-ethynyl-7-fluoronaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine |
|---|---|
| PubChem CID | 167179754 |
| Molecular Formula | C34H38FN5O |
| Molecular Weight | 551.71 g/mol |
| Exact Mass | 551.31 |
| IUPAC Name | 4-[(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl]-7-(8-ethynyl-7-fluoronaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine |
| SMILES | C#Cc1c(F)ccc2cccc(N3CCc4c(nc(OCC56CCCN5CCC6)nc4C4C[C@H]5CC[C@@H](C4)N5)C3)c12 |
| InChI | InChI=1S/C34H38FN5O/c1-2-26-28(35)11-8-22-6-3-7-30(31(22)26)39-17-12-27-29(20-39)37-33(41-21-34-13-4-15-40(34)16-5-14-34)38-32(27)23-18-24-9-10-25(19-23)36-24/h1,3,6-8,11,23-25,36H,4-5,9-10,12-21H2/t23?,24-,25+ |
| InChIKey | PTTIJBYMUQBRKC-QILAJZQNSA-N |
| XLogP | 5.32 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.71 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|