C35H38N6O — CID 168918589
1-(3,8-diazabicyclo[3.2.1]octan-3-yl)-6-(8-ethynylnaphthalen-1-yl)-3-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-7,8-dihydro-5H-2,6-naphthyridine-4-carbonitrile (PubChem CID 168918589) has the molecular formula C35H38N6O and a molecular weight of 558.73 g/mol. Its IUPAC name is 1-(3,8-diazabicyclo[3.2.1]octan-3-yl)-6-(8-ethynylnaphthalen-1-yl)-3-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-7,8-dihydro-5H-2,6-naphthyridine-4-carbonitrile.
| Compound Name | 1-(3,8-diazabicyclo[3.2.1]octan-3-yl)-6-(8-ethynylnaphthalen-1-yl)-3-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-7,8-dihydro-5H-2,6-naphthyridine-4-carbonitrile |
|---|---|
| PubChem CID | 168918589 |
| Molecular Formula | C35H38N6O |
| Molecular Weight | 558.73 g/mol |
| Exact Mass | 558.31 |
| IUPAC Name | 1-(3,8-diazabicyclo[3.2.1]octan-3-yl)-6-(8-ethynylnaphthalen-1-yl)-3-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-7,8-dihydro-5H-2,6-naphthyridine-4-carbonitrile |
| SMILES | C#Cc1cccc2cccc(N3CCc4c(N5CC6CCC(C5)N6)nc(OCC56CCCN5CCC6)c(C#N)c4C3)c12 |
| InChI | InChI=1S/C35H38N6O/c1-2-24-7-3-8-25-9-4-10-31(32(24)25)39-18-13-28-30(22-39)29(19-36)34(42-23-35-14-5-16-41(35)17-6-15-35)38-33(28)40-20-26-11-12-27(21-40)37-26/h1,3-4,7-10,26-27,37H,5-6,11-18,20-23H2 |
| InChIKey | QAJUWJPDFKAIRK-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 67.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.73 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|