C33H37FN6O — CID 167179623
4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-7-(8-ethynyl-7-fluoronaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine (PubChem CID 167179623) has the molecular formula C33H37FN6O and a molecular weight of 552.70 g/mol. Its IUPAC name is 4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-7-(8-ethynyl-7-fluoronaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine.
| Compound Name | 4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-7-(8-ethynyl-7-fluoronaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine |
|---|---|
| PubChem CID | 167179623 |
| Molecular Formula | C33H37FN6O |
| Molecular Weight | 552.70 g/mol |
| Exact Mass | 552.30 |
| IUPAC Name | 4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-7-(8-ethynyl-7-fluoronaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine |
| SMILES | C#Cc1c(F)ccc2cccc(N3CCc4c(nc(OCC56CCCN5CCC6)nc4N4CC5CCC(C4)N5)C3)c12 |
| InChI | InChI=1S/C33H37FN6O/c1-2-25-27(34)11-8-22-6-3-7-29(30(22)25)38-17-12-26-28(20-38)36-32(41-21-33-13-4-15-40(33)16-5-14-33)37-31(26)39-18-23-9-10-24(19-39)35-23/h1,3,6-8,11,23-24,35H,4-5,9-10,12-21H2 |
| InChIKey | PGJYKLVWJGHHHY-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 56.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.70 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|