C39H42N6O3 — CID 176630845
benzyl 4-[4-cyano-3-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-6-naphthalen-1-yl-7,8-dihydro-5H-2,6-naphthyridin-1-yl]piperazine-1-carboxylate (PubChem CID 176630845) has the molecular formula C39H42N6O3 and a molecular weight of 642.80 g/mol. Its IUPAC name is benzyl 4-[4-cyano-3-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-6-naphthalen-1-yl-7,8-dihydro-5H-2,6-naphthyridin-1-yl]piperazine-1-carboxylate.
| Compound Name | benzyl 4-[4-cyano-3-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-6-naphthalen-1-yl-7,8-dihydro-5H-2,6-naphthyridin-1-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 176630845 |
| Molecular Formula | C39H42N6O3 |
| Molecular Weight | 642.80 g/mol |
| Exact Mass | 642.33 |
| IUPAC Name | benzyl 4-[4-cyano-3-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-6-naphthalen-1-yl-7,8-dihydro-5H-2,6-naphthyridin-1-yl]piperazine-1-carboxylate |
| SMILES | N#Cc1c(OCC23CCCN2CCC3)nc(N2CCN(C(=O)OCc3ccccc3)CC2)c2c1CN(c1cccc3ccccc13)CC2 |
| InChI | InChI=1S/C39H42N6O3/c40-25-33-34-26-44(35-14-6-12-30-11-4-5-13-31(30)35)20-15-32(34)36(41-37(33)48-28-39-16-7-18-45(39)19-8-17-39)42-21-23-43(24-22-42)38(46)47-27-29-9-2-1-3-10-29/h1-6,9-14H,7-8,15-24,26-28H2 |
| InChIKey | BDEGSCICRVOBJR-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 85.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.80 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |