C13H22N8O2S2 — CID 170370140
1-acetamidoethyl (1Z,3S)-3-[(5-acetamido-1,3,4-thiadiazol-2-yl)amino]-N-aminopyrrolidine-1-carboximidothioate (PubChem CID 170370140) has the molecular formula C13H22N8O2S2 and a molecular weight of 386.51 g/mol. Its IUPAC name is 1-acetamidoethyl (1Z,3S)-3-[(5-acetamido-1,3,4-thiadiazol-2-yl)amino]-N-aminopyrrolidine-1-carboximidothioate.
| Compound Name | 1-acetamidoethyl (1Z,3S)-3-[(5-acetamido-1,3,4-thiadiazol-2-yl)amino]-N-aminopyrrolidine-1-carboximidothioate |
|---|---|
| PubChem CID | 170370140 |
| Molecular Formula | C13H22N8O2S2 |
| Molecular Weight | 386.51 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 1-acetamidoethyl (1Z,3S)-3-[(5-acetamido-1,3,4-thiadiazol-2-yl)amino]-N-aminopyrrolidine-1-carboximidothioate |
| SMILES | CC(=O)Nc1nnc(N[C@H]2CCN(/C(=N/N)SC(C)NC(C)=O)C2)s1 |
| InChI | InChI=1S/C13H22N8O2S2/c1-7(22)15-9(3)24-13(18-14)21-5-4-10(6-21)17-12-20-19-11(25-12)16-8(2)23/h9-10H,4-6,14H2,1-3H3,(H,15,22)(H,17,20)(H,16,19,23)/b18-13-/t9?,10-/m0/s1 |
| InChIKey | MXAZKWUAXFSIMR-KIAJZUCSSA-N |
| XLogP | 0.43 |
| TPSA | 137.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.51 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|