C12H13N3O6S2 — CID 170372081
N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-N-methyl-2-nitrobenzenesulfonamide (PubChem CID 170372081) has the molecular formula C12H13N3O6S2 and a molecular weight of 359.39 g/mol. Its IUPAC name is N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-N-methyl-2-nitrobenzenesulfonamide.
| Compound Name | N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-N-methyl-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 170372081 |
| Molecular Formula | C12H13N3O6S2 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.02 |
| IUPAC Name | N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-N-methyl-2-nitrobenzenesulfonamide |
| SMILES | CN(CCN1C(=O)CSC1=O)S(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H13N3O6S2/c1-13(6-7-14-11(16)8-22-12(14)17)23(20,21)10-5-3-2-4-9(10)15(18)19/h2-5H,6-8H2,1H3 |
| InChIKey | OQOXADIBUVZWRQ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 117.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|