C19H25FN2O4 — CID 170376503
2-(5-cyclopropyl-7-fluoro-3,3-dimethyl-2-oxoindol-1-yl)-N-(4,4-dihydroxybutyl)acetamide (PubChem CID 170376503) has the molecular formula C19H25FN2O4 and a molecular weight of 364.42 g/mol. Its IUPAC name is 2-(5-cyclopropyl-7-fluoro-3,3-dimethyl-2-oxoindol-1-yl)-N-(4,4-dihydroxybutyl)acetamide.
| Compound Name | 2-(5-cyclopropyl-7-fluoro-3,3-dimethyl-2-oxoindol-1-yl)-N-(4,4-dihydroxybutyl)acetamide |
|---|---|
| PubChem CID | 170376503 |
| Molecular Formula | C19H25FN2O4 |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 2-(5-cyclopropyl-7-fluoro-3,3-dimethyl-2-oxoindol-1-yl)-N-(4,4-dihydroxybutyl)acetamide |
| SMILES | CC1(C)C(=O)N(CC(=O)NCCCC(O)O)c2c(F)cc(C3CC3)cc21 |
| InChI | InChI=1S/C19H25FN2O4/c1-19(2)13-8-12(11-5-6-11)9-14(20)17(13)22(18(19)26)10-15(23)21-7-3-4-16(24)25/h8-9,11,16,24-25H,3-7,10H2,1-2H3,(H,21,23) |
| InChIKey | LEEVMFOZPHDGGE-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|