C17H21BrN2O4 — CID 170324171
methyl 4-[[2-(5-bromo-3,3-dimethyl-2-oxoindol-1-yl)acetyl]amino]butanoate (PubChem CID 170324171) has the molecular formula C17H21BrN2O4 and a molecular weight of 397.27 g/mol. Its IUPAC name is methyl 4-[[2-(5-bromo-3,3-dimethyl-2-oxoindol-1-yl)acetyl]amino]butanoate.
| Compound Name | methyl 4-[[2-(5-bromo-3,3-dimethyl-2-oxoindol-1-yl)acetyl]amino]butanoate |
|---|---|
| PubChem CID | 170324171 |
| Molecular Formula | C17H21BrN2O4 |
| Molecular Weight | 397.27 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | methyl 4-[[2-(5-bromo-3,3-dimethyl-2-oxoindol-1-yl)acetyl]amino]butanoate |
| SMILES | COC(=O)CCCNC(=O)CN1C(=O)C(C)(C)c2cc(Br)ccc21 |
| InChI | InChI=1S/C17H21BrN2O4/c1-17(2)12-9-11(18)6-7-13(12)20(16(17)23)10-14(21)19-8-4-5-15(22)24-3/h6-7,9H,4-5,8,10H2,1-3H3,(H,19,21) |
| InChIKey | RWYRTPJMGRZWSQ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.27 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|