About methyl 4-[[2-(5-bromo-3,3-dimethyl-2-oxoindol-1-yl)acetyl]amino]butanoate
methyl 4-[[2-(5-bromo-3,3-dimethyl-2-oxoindol-1-yl)acetyl]amino]butanoate (PubChem CID 170324171) has the molecular formula C17H21BrN2O4
and a molecular weight of 397.27 g/mol. Its IUPAC name is methyl 4-[[2-(5-bromo-3,3-dimethyl-2-oxoindol-1-yl)acetyl]amino]butanoate.
Molecular Properties
| Compound Name | methyl 4-[[2-(5-bromo-3,3-dimethyl-2-oxoindol-1-yl)acetyl]amino]butanoate |
| PubChem CID | 170324171 |
| Molecular Formula | C17H21BrN2O4 |
| Molecular Weight | 397.27 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | methyl 4-[[2-(5-bromo-3,3-dimethyl-2-oxoindol-1-yl)acetyl]amino]butanoate |
| SMILES | COC(=O)CCCNC(=O)CN1C(=O)C(C)(C)c2cc(Br)ccc21 |
| InChI | InChI=1S/C17H21BrN2O4/c1-17(2)12-9-11(18)6-7-13(12)20(16(17)23)10-14(21)19-8-4-5-15(22)24-3/h6-7,9H,4-5,8,10H2,1-3H3,(H,19,21) |
| InChIKey | RWYRTPJMGRZWSQ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.27 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-[[2-(5-bromo-3,3-dimethyl-2-oxoindol-1-yl)acetyl]amino]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[[2-(5-bromo-3,3-dimethyl-2-oxoindol-1-yl)acetyl]amino]butanoate?
The IUPAC name of methyl 4-[[2-(5-bromo-3,3-dimethyl-2-oxoindol-1-yl)acetyl]amino]butanoate (CID 170324171) is methyl 4-[[2-(5-bromo-3,3-dimethyl-2-oxoindol-1-yl)acetyl]amino]butanoate.
What is the SMILES notation for methyl 4-[[2-(5-bromo-3,3-dimethyl-2-oxoindol-1-yl)acetyl]amino]butanoate?
The canonical SMILES for methyl 4-[[2-(5-bromo-3,3-dimethyl-2-oxoindol-1-yl)acetyl]amino]butanoate is COC(=O)CCCNC(=O)CN1C(=O)C(C)(C)c2cc(Br)ccc21.
What is the InChIKey of methyl 4-[[2-(5-bromo-3,3-dimethyl-2-oxoindol-1-yl)acetyl]amino]butanoate?
The InChIKey is RWYRTPJMGRZWSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21BrN2O4/c1-17(2)12-9-11(18)6-7-13(12)20(16(17)23)10-14(21)19-8-4-5-15(22)24-3/h6-7,9H,4-5,8,10H2,1-3H3,(H,19,21).
What are the key properties of methyl 4-[[2-(5-bromo-3,3-dimethyl-2-oxoindol-1-yl)acetyl]amino]butanoate?
methyl 4-[[2-(5-bromo-3,3-dimethyl-2-oxoindol-1-yl)acetyl]amino]butanoate has a molecular weight of 397.27 g/mol, XLogP of 2.14, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[[2-(5-bromo-3,3-dimethyl-2-oxoindol-1-yl)acetyl]amino]butanoate is sourced from PubChem (CID 170324171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).