C20H18BrNO5 — CID 5309295
methyl 2-[5-bromo-3-hydroxy-3-[2-(4-methylphenyl)-2-oxoethyl]-2-oxoindol-1-yl]acetate (PubChem CID 5309295) has the molecular formula C20H18BrNO5 and a molecular weight of 432.27 g/mol. Its IUPAC name is methyl 2-[5-bromo-3-hydroxy-3-[2-(4-methylphenyl)-2-oxoethyl]-2-oxoindol-1-yl]acetate.
| Compound Name | methyl 2-[5-bromo-3-hydroxy-3-[2-(4-methylphenyl)-2-oxoethyl]-2-oxoindol-1-yl]acetate |
|---|---|
| PubChem CID | 5309295 |
| Molecular Formula | C20H18BrNO5 |
| Molecular Weight | 432.27 g/mol |
| Exact Mass | 431.04 |
| IUPAC Name | methyl 2-[5-bromo-3-hydroxy-3-[2-(4-methylphenyl)-2-oxoethyl]-2-oxoindol-1-yl]acetate |
| SMILES | COC(=O)CN1C(=O)C(O)(CC(=O)c2ccc(C)cc2)c2cc(Br)ccc21 |
| InChI | InChI=1S/C20H18BrNO5/c1-12-3-5-13(6-4-12)17(23)10-20(26)15-9-14(21)7-8-16(15)22(19(20)25)11-18(24)27-2/h3-9,26H,10-11H2,1-2H3 |
| InChIKey | TXRCCSOLOJKLNZ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.27 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |