C24H26BrNO5 — CID 41290460
butyl 2-[(3R)-5-bromo-3-[2-(2,4-dimethylphenyl)-2-oxoethyl]-3-hydroxy-2-oxoindol-1-yl]acetate (PubChem CID 41290460) has the molecular formula C24H26BrNO5 and a molecular weight of 488.38 g/mol. Its IUPAC name is butyl 2-[(3R)-5-bromo-3-[2-(2,4-dimethylphenyl)-2-oxoethyl]-3-hydroxy-2-oxoindol-1-yl]acetate.
| Compound Name | butyl 2-[(3R)-5-bromo-3-[2-(2,4-dimethylphenyl)-2-oxoethyl]-3-hydroxy-2-oxoindol-1-yl]acetate |
|---|---|
| PubChem CID | 41290460 |
| Molecular Formula | C24H26BrNO5 |
| Molecular Weight | 488.38 g/mol |
| Exact Mass | 487.10 |
| IUPAC Name | butyl 2-[(3R)-5-bromo-3-[2-(2,4-dimethylphenyl)-2-oxoethyl]-3-hydroxy-2-oxoindol-1-yl]acetate |
| SMILES | CCCCOC(=O)CN1C(=O)[C@@](O)(CC(=O)c2ccc(C)cc2C)c2cc(Br)ccc21 |
| InChI | InChI=1S/C24H26BrNO5/c1-4-5-10-31-22(28)14-26-20-9-7-17(25)12-19(20)24(30,23(26)29)13-21(27)18-8-6-15(2)11-16(18)3/h6-9,11-12,30H,4-5,10,13-14H2,1-3H3/t24-/m1/s1 |
| InChIKey | WTAUNJDOZZJNEE-XMMPIXPASA-N |
| XLogP | 4.22 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.38 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|