C17H21ClN4O — CID 170381656
5-chloro-2-[5-methyl-6-[[(3R)-1-methylpiperidin-3-yl]amino]pyridazin-3-yl]phenol (PubChem CID 170381656) has the molecular formula C17H21ClN4O and a molecular weight of 332.84 g/mol. Its IUPAC name is 5-chloro-2-[5-methyl-6-[[(3R)-1-methylpiperidin-3-yl]amino]pyridazin-3-yl]phenol.
| Compound Name | 5-chloro-2-[5-methyl-6-[[(3R)-1-methylpiperidin-3-yl]amino]pyridazin-3-yl]phenol |
|---|---|
| PubChem CID | 170381656 |
| Molecular Formula | C17H21ClN4O |
| Molecular Weight | 332.84 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 5-chloro-2-[5-methyl-6-[[(3R)-1-methylpiperidin-3-yl]amino]pyridazin-3-yl]phenol |
| SMILES | Cc1cc(-c2ccc(Cl)cc2O)nnc1N[C@@H]1CCCN(C)C1 |
| InChI | InChI=1S/C17H21ClN4O/c1-11-8-15(14-6-5-12(18)9-16(14)23)20-21-17(11)19-13-4-3-7-22(2)10-13/h5-6,8-9,13,23H,3-4,7,10H2,1-2H3,(H,19,21)/t13-/m1/s1 |
| InChIKey | SPPRRNSNSWWIPD-CYBMUJFWSA-N |
| XLogP | 3.32 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.84 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |