C19H23N5O2 — CID 171545313
3-(2-hydroxy-4-prop-1-ynylphenyl)-4-methyl-6-[[(3R)-1-methylpiperidin-3-yl]amino]-1,2,4-triazin-5-one (PubChem CID 171545313) has the molecular formula C19H23N5O2 and a molecular weight of 353.43 g/mol. Its IUPAC name is 3-(2-hydroxy-4-prop-1-ynylphenyl)-4-methyl-6-[[(3R)-1-methylpiperidin-3-yl]amino]-1,2,4-triazin-5-one.
| Compound Name | 3-(2-hydroxy-4-prop-1-ynylphenyl)-4-methyl-6-[[(3R)-1-methylpiperidin-3-yl]amino]-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 171545313 |
| Molecular Formula | C19H23N5O2 |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | 3-(2-hydroxy-4-prop-1-ynylphenyl)-4-methyl-6-[[(3R)-1-methylpiperidin-3-yl]amino]-1,2,4-triazin-5-one |
| SMILES | CC#Cc1ccc(-c2nnc(N[C@@H]3CCCN(C)C3)c(=O)n2C)c(O)c1 |
| InChI | InChI=1S/C19H23N5O2/c1-4-6-13-8-9-15(16(25)11-13)18-22-21-17(19(26)24(18)3)20-14-7-5-10-23(2)12-14/h8-9,11,14,25H,5,7,10,12H2,1-3H3,(H,20,21)/t14-/m1/s1 |
| InChIKey | ZBMPHSPGROXOHX-CQSZACIVSA-N |
| XLogP | 1.43 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|