C18H22F2N4O — CID 170381735
2-[6-[[(3R)-1-ethylpiperidin-3-yl]amino]-4-fluoropyridazin-3-yl]-5-fluoro-3-methylphenol (PubChem CID 170381735) has the molecular formula C18H22F2N4O and a molecular weight of 348.40 g/mol. Its IUPAC name is 2-[6-[[(3R)-1-ethylpiperidin-3-yl]amino]-4-fluoropyridazin-3-yl]-5-fluoro-3-methylphenol.
| Compound Name | 2-[6-[[(3R)-1-ethylpiperidin-3-yl]amino]-4-fluoropyridazin-3-yl]-5-fluoro-3-methylphenol |
|---|---|
| PubChem CID | 170381735 |
| Molecular Formula | C18H22F2N4O |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 2-[6-[[(3R)-1-ethylpiperidin-3-yl]amino]-4-fluoropyridazin-3-yl]-5-fluoro-3-methylphenol |
| SMILES | CCN1CCC[C@@H](Nc2cc(F)c(-c3c(C)cc(F)cc3O)nn2)C1 |
| InChI | InChI=1S/C18H22F2N4O/c1-3-24-6-4-5-13(10-24)21-16-9-14(20)18(23-22-16)17-11(2)7-12(19)8-15(17)25/h7-9,13,25H,3-6,10H2,1-2H3,(H,21,22)/t13-/m1/s1 |
| InChIKey | CUBCGUSLPASBJG-CYBMUJFWSA-N |
| XLogP | 3.33 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |