C35H38ClF3N6S2 — CID 170382643
N-[4-amino-3-(trifluoromethylsulfanyl)phenyl]sulfanyl-7-[4-[[2-(4-chlorophenyl)-5-propan-2-ylcyclohexen-1-yl]methyl]piperazin-1-yl]quinazolin-4-amine (PubChem CID 170382643) has the molecular formula C35H38ClF3N6S2 and a molecular weight of 699.31 g/mol. Its IUPAC name is N-[4-amino-3-(trifluoromethylsulfanyl)phenyl]sulfanyl-7-[4-[[2-(4-chlorophenyl)-5-propan-2-ylcyclohexen-1-yl]methyl]piperazin-1-yl]quinazolin-4-amine.
| Compound Name | N-[4-amino-3-(trifluoromethylsulfanyl)phenyl]sulfanyl-7-[4-[[2-(4-chlorophenyl)-5-propan-2-ylcyclohexen-1-yl]methyl]piperazin-1-yl]quinazolin-4-amine |
|---|---|
| PubChem CID | 170382643 |
| Molecular Formula | C35H38ClF3N6S2 |
| Molecular Weight | 699.31 g/mol |
| Exact Mass | 698.22 |
| IUPAC Name | N-[4-amino-3-(trifluoromethylsulfanyl)phenyl]sulfanyl-7-[4-[[2-(4-chlorophenyl)-5-propan-2-ylcyclohexen-1-yl]methyl]piperazin-1-yl]quinazolin-4-amine |
| SMILES | CC(C)C1CCC(c2ccc(Cl)cc2)=C(CN2CCN(c3ccc4c(NSc5ccc(N)c(SC(F)(F)F)c5)ncnc4c3)CC2)C1 |
| InChI | InChI=1S/C35H38ClF3N6S2/c1-22(2)24-5-10-29(23-3-6-26(36)7-4-23)25(17-24)20-44-13-15-45(16-14-44)27-8-11-30-32(18-27)41-21-42-34(30)43-47-28-9-12-31(40)33(19-28)46-35(37,38)39/h3-4,6-9,11-12,18-19,21-22,24H,5,10,13-17,20,40H2,1-2H3,(H,41,42,43) |
| InChIKey | QGBDPEZKBREFGB-UHFFFAOYSA-N |
| XLogP | 9.63 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.31 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|