C39H45ClN8O2S — CID 145388263
N-[4-[[7-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]quinazolin-4-yl]amino]sulfanyl-2-nitrophenyl]-N'-methyl-N'-(2-methylpropyl)propane-1,3-diamine (PubChem CID 145388263) has the molecular formula C39H45ClN8O2S and a molecular weight of 725.36 g/mol. Its IUPAC name is N-[4-[[7-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]quinazolin-4-yl]amino]sulfanyl-2-nitrophenyl]-N'-methyl-N'-(2-methylpropyl)propane-1,3-diamine.
| Compound Name | N-[4-[[7-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]quinazolin-4-yl]amino]sulfanyl-2-nitrophenyl]-N'-methyl-N'-(2-methylpropyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 145388263 |
| Molecular Formula | C39H45ClN8O2S |
| Molecular Weight | 725.36 g/mol |
| Exact Mass | 724.31 |
| IUPAC Name | N-[4-[[7-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]quinazolin-4-yl]amino]sulfanyl-2-nitrophenyl]-N'-methyl-N'-(2-methylpropyl)propane-1,3-diamine |
| SMILES | CC(C)CN(C)CCCNc1ccc(SNc2ncnc3cc(N4CCN(Cc5ccccc5-c5ccc(Cl)cc5)CC4)ccc23)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C39H45ClN8O2S/c1-28(2)25-45(3)18-6-17-41-36-16-14-33(24-38(36)48(49)50)51-44-39-35-15-13-32(23-37(35)42-27-43-39)47-21-19-46(20-22-47)26-30-7-4-5-8-34(30)29-9-11-31(40)12-10-29/h4-5,7-16,23-24,27-28,41H,6,17-22,25-26H2,1-3H3,(H,42,43,44) |
| InChIKey | CHJISMODWDFAPL-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 102.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.36 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|