C10H21N — CID 170383995
(2R)-2-methyl-1,2-di(propan-2-yl)azetidine (PubChem CID 170383995) has the molecular formula C10H21N and a molecular weight of 155.28 g/mol. Its IUPAC name is (2R)-2-methyl-1,2-di(propan-2-yl)azetidine.
| Compound Name | (2R)-2-methyl-1,2-di(propan-2-yl)azetidine |
|---|---|
| PubChem CID | 170383995 |
| Molecular Formula | C10H21N |
| Molecular Weight | 155.28 g/mol |
| Exact Mass | 155.17 |
| IUPAC Name | (2R)-2-methyl-1,2-di(propan-2-yl)azetidine |
| SMILES | CC(C)N1CC[C@]1(C)C(C)C |
| InChI | InChI=1S/C10H21N/c1-8(2)10(5)6-7-11(10)9(3)4/h8-9H,6-7H2,1-5H3/t10-/m1/s1 |
| InChIKey | XXWDFTOMBPLUEB-SNVBAGLBSA-N |
| XLogP | 2.52 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.28 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |